C15H19N3O3 — CID 136589158
(1S,3S,5S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]bicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 136589158) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1S,3S,5S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]bicyclo[3.1.0]hexane-1-carboxylic acid.
| Compound Name | (1S,3S,5S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]bicyclo[3.1.0]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 136589158 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (1S,3S,5S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]bicyclo[3.1.0]hexane-1-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)N[C@H]2C[C@@H]3C[C@]3(C(=O)O)C2)N=N1 |
| InChI | InChI=1S/C15H19N3O3/c1-2-3-5-15(17-18-15)6-4-12(19)16-11-7-10-8-14(10,9-11)13(20)21/h1,10-11H,3-9H2,(H,16,19)(H,20,21)/t10-,11+,14+/m1/s1 |
| InChIKey | IMNQSLFXEXSNPN-SUNKGSAMSA-N |
| XLogP | 1.71 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|