C16H18F3N5O — CID 154870378
3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]propanamide (PubChem CID 154870378) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]propanamide |
|---|---|
| PubChem CID | 154870378 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-6-yl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NC2Cc3[nH]ncc3C(C(F)(F)F)C2)N=N1 |
| InChI | InChI=1S/C16H18F3N5O/c1-2-3-5-15(23-24-15)6-4-14(25)21-10-7-12(16(17,18)19)11-9-20-22-13(11)8-10/h1,9-10,12H,3-8H2,(H,20,22)(H,21,25) |
| InChIKey | RQPKFBJCXRMDHS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|