C14H19N5O2 — CID 136590916
N-(1,3-benzodioxol-5-ylmethyl)-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590916) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590916 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C/N=C1/NC(N(C)Cc2ccc3c(c2)OCO3)=NC(C)N1 |
| InChI | InChI=1S/C14H19N5O2/c1-9-16-13(15-2)18-14(17-9)19(3)7-10-4-5-11-12(6-10)21-8-20-11/h4-6,9H,7-8H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | RTPUVELLZMUAFC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|