C10H15N5S — CID 136591026
2-methyl-6-(2-thiophen-3-ylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136591026) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-methyl-6-(2-thiophen-3-ylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 2-methyl-6-(2-thiophen-3-ylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136591026 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-methyl-6-(2-thiophen-3-ylethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC1N=C(N)N/C(=N/CCc2ccsc2)N1 |
| InChI | InChI=1S/C10H15N5S/c1-7-13-9(11)15-10(14-7)12-4-2-8-3-5-16-6-8/h3,5-7H,2,4H2,1H3,(H4,11,12,13,14,15) |
| InChIKey | QCWMMRWEPFOLCH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|