C22H20N4O4S — CID 136595127
3-[4-[[5-(6-methoxy-3-pyridinyl)-2,3,7,7a-tetrahydroindol-1-yl]sulfinyl]phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136595127) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 3-[4-[[5-(6-methoxy-3-pyridinyl)-2,3,7,7a-tetrahydroindol-1-yl]sulfinyl]phenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-[[5-(6-methoxy-3-pyridinyl)-2,3,7,7a-tetrahydroindol-1-yl]sulfinyl]phenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136595127 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-[4-[[5-(6-methoxy-3-pyridinyl)-2,3,7,7a-tetrahydroindol-1-yl]sulfinyl]phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | COc1ccc(C2=CCC3C(=C2)CCN3S(=O)c2ccc(-c3noc(=O)[nH]3)cc2)cn1 |
| InChI | InChI=1S/C22H20N4O4S/c1-29-20-9-5-17(13-23-20)15-4-8-19-16(12-15)10-11-26(19)31(28)18-6-2-14(3-7-18)21-24-22(27)30-25-21/h2-7,9,12-13,19H,8,10-11H2,1H3,(H,24,25,27) |
| InChIKey | IFLJSDIGDOXCDO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |