C18H13NO5S — CID 136601792
3-(4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-3-yl)-1-benzofuran-2-carbaldehyde (PubChem CID 136601792) has the molecular formula C18H13NO5S and a molecular weight of 355.37 g/mol. Its IUPAC name is 3-(4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-3-yl)-1-benzofuran-2-carbaldehyde.
| Compound Name | 3-(4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-3-yl)-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 136601792 |
| Molecular Formula | C18H13NO5S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3-(4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-3-yl)-1-benzofuran-2-carbaldehyde |
| SMILES | CN1C(c2c(C=O)oc3ccccc23)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H13NO5S/c1-19-17(16-11-6-2-4-8-13(11)24-14(16)10-20)18(21)12-7-3-5-9-15(12)25(19,22)23/h2-10,21H,1H3 |
| InChIKey | LVPPOIFSAXVVCH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|