C9H8N2O — CID 136607358
5-methyl-2,6-naphthyridin-4-ol (PubChem CID 136607358) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 5-methyl-2,6-naphthyridin-4-ol.
| Compound Name | 5-methyl-2,6-naphthyridin-4-ol |
|---|---|
| PubChem CID | 136607358 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 5-methyl-2,6-naphthyridin-4-ol |
| SMILES | Cc1nccc2cncc(O)c12 |
| InChI | InChI=1S/C9H8N2O/c1-6-9-7(2-3-11-6)4-10-5-8(9)12/h2-5,12H,1H3 |
| InChIKey | UEBKNTNEGOPCOE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |