C24H16N2O6 — CID 1366088
2,6-bis(2-hydroxy-5-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 1366088) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is 2,6-bis(2-hydroxy-5-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(2-hydroxy-5-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 1366088 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2,6-bis(2-hydroxy-5-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(O)c(-n2c(=O)c3cc4c(=O)n(-c5cc(C)ccc5O)c(=O)c4cc3c2=O)c1 |
| InChI | InChI=1S/C24H16N2O6/c1-11-3-5-19(27)17(7-11)25-21(29)13-9-15-16(10-14(13)22(25)30)24(32)26(23(15)31)18-8-12(2)4-6-20(18)28/h3-10,27-28H,1-2H3 |
| InChIKey | WAZUBLWGJREPSM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |