C18H21NO4S — CID 136613805
ethyl 3-hydroxy-5-[3-(3-methoxybut-3-enyl)phenyl]imino-2H-thiophene-4-carboxylate (PubChem CID 136613805) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is ethyl 3-hydroxy-5-[3-(3-methoxybut-3-enyl)phenyl]imino-2H-thiophene-4-carboxylate.
| Compound Name | ethyl 3-hydroxy-5-[3-(3-methoxybut-3-enyl)phenyl]imino-2H-thiophene-4-carboxylate |
|---|---|
| PubChem CID | 136613805 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | ethyl 3-hydroxy-5-[3-(3-methoxybut-3-enyl)phenyl]imino-2H-thiophene-4-carboxylate |
| SMILES | C=C(CCc1cccc(/N=C2\SCC(O)=C2C(=O)OCC)c1)OC |
| InChI | InChI=1S/C18H21NO4S/c1-4-23-18(21)16-15(20)11-24-17(16)19-14-7-5-6-13(10-14)9-8-12(2)22-3/h5-7,10,20H,2,4,8-9,11H2,1,3H3/b19-17- |
| InChIKey | FRBJZWYKWQVDQJ-ZPHPHTNESA-N |
| XLogP | 3.93 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|