C15H17NO3S — CID 135776300
ethyl 5-(3,5-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate (PubChem CID 135776300) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl 5-(3,5-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate.
| Compound Name | ethyl 5-(3,5-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
|---|---|
| PubChem CID | 135776300 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl 5-(3,5-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CS/C1=N\c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H17NO3S/c1-4-19-15(18)13-12(17)8-20-14(13)16-11-6-9(2)5-10(3)7-11/h5-7,17H,4,8H2,1-3H3/b16-14- |
| InChIKey | NWHYSAGNPAHOJX-PEZBUJJGSA-N |
| XLogP | 3.46 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|