C14H14ClNO3S — CID 135776304
ethyl 5-(4-chloro-2-methylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate (PubChem CID 135776304) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is ethyl 5-(4-chloro-2-methylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate.
| Compound Name | ethyl 5-(4-chloro-2-methylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
|---|---|
| PubChem CID | 135776304 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | ethyl 5-(4-chloro-2-methylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CS/C1=N\c1ccc(Cl)cc1C |
| InChI | InChI=1S/C14H14ClNO3S/c1-3-19-14(18)12-11(17)7-20-13(12)16-10-5-4-9(15)6-8(10)2/h4-6,17H,3,7H2,1-2H3/b16-13- |
| InChIKey | ZXMYCKLTXBJHOQ-SSZFMOIBSA-N |
| XLogP | 3.80 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|