C19H18IN5O3 — CID 136621804
3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carboxamide (PubChem CID 136621804) has the molecular formula C19H18IN5O3 and a molecular weight of 491.29 g/mol. Its IUPAC name is 3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136621804 |
| Molecular Formula | C19H18IN5O3 |
| Molecular Weight | 491.29 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 3-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carboxamide |
| SMILES | COc1cc(/C=N/c2n[nH]c(Nc3cccc(CI)c3)c2C(N)=O)ccc1O |
| InChI | InChI=1S/C19H18IN5O3/c1-28-15-8-12(5-6-14(15)26)10-22-18-16(17(21)27)19(25-24-18)23-13-4-2-3-11(7-13)9-20/h2-8,10,26H,9H2,1H3,(H2,21,27)(H2,23,24,25)/b22-10+ |
| InChIKey | JFIDXPMPLXZAGG-LSHDLFTRSA-N |
| XLogP | 3.65 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|