C16H13IN6 — CID 136621815
5-[3-(iodomethyl)anilino]-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carbonitrile (PubChem CID 136621815) has the molecular formula C16H13IN6 and a molecular weight of 416.23 g/mol. Its IUPAC name is 5-[3-(iodomethyl)anilino]-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-[3-(iodomethyl)anilino]-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 136621815 |
| Molecular Formula | C16H13IN6 |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 5-[3-(iodomethyl)anilino]-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(/N=C/c2ccc[nH]2)n[nH]c1Nc1cccc(CI)c1 |
| InChI | InChI=1S/C16H13IN6/c17-8-11-3-1-4-12(7-11)21-16-14(9-18)15(22-23-16)20-10-13-5-2-6-19-13/h1-7,10,19H,8H2,(H2,21,22,23)/b20-10+ |
| InChIKey | RUUBFJAQILCAEB-KEBDBYFISA-N |
| XLogP | 4.04 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|