C20H17ClN4 — CID 158332931
5-[(3-chlorophenyl)methyl]-3-[(2,4-dimethylphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile (PubChem CID 158332931) has the molecular formula C20H17ClN4 and a molecular weight of 348.84 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-3-[(2,4-dimethylphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-[(3-chlorophenyl)methyl]-3-[(2,4-dimethylphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 158332931 |
| Molecular Formula | C20H17ClN4 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-3-[(2,4-dimethylphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile |
| SMILES | Cc1ccc(/C=N/c2n[nH]c(Cc3cccc(Cl)c3)c2C#N)c(C)c1 |
| InChI | InChI=1S/C20H17ClN4/c1-13-6-7-16(14(2)8-13)12-23-20-18(11-22)19(24-25-20)10-15-4-3-5-17(21)9-15/h3-9,12H,10H2,1-2H3,(H,24,25)/b23-12+ |
| InChIKey | NSVPQIYZFJZQHG-FSJBWODESA-N |
| XLogP | 4.89 |
| TPSA | 64.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|