C18H16ClN5O2 — CID 136621809
5-(3-chloroanilino)-3-[(2-hydroxy-4-methylphenyl)methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 136621809) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 5-(3-chloroanilino)-3-[(2-hydroxy-4-methylphenyl)methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chloroanilino)-3-[(2-hydroxy-4-methylphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136621809 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-(3-chloroanilino)-3-[(2-hydroxy-4-methylphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1ccc(/C=N/c2n[nH]c(Nc3cccc(Cl)c3)c2C(N)=O)c(O)c1 |
| InChI | InChI=1S/C18H16ClN5O2/c1-10-5-6-11(14(25)7-10)9-21-17-15(16(20)26)18(24-23-17)22-13-4-2-3-12(19)8-13/h2-9,25H,1H3,(H2,20,26)(H2,22,23,24)/b21-9+ |
| InChIKey | GYRQDQFYCVWHFD-ZVBGSRNCSA-N |
| XLogP | 3.67 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|