C15H15ClN6O — CID 71765595
5-(3-chloroanilino)-3-(1H-pyrrol-2-ylmethylamino)-1H-pyrazole-4-carboxamide (PubChem CID 71765595) has the molecular formula C15H15ClN6O and a molecular weight of 330.78 g/mol. Its IUPAC name is 5-(3-chloroanilino)-3-(1H-pyrrol-2-ylmethylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chloroanilino)-3-(1H-pyrrol-2-ylmethylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71765595 |
| Molecular Formula | C15H15ClN6O |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 5-(3-chloroanilino)-3-(1H-pyrrol-2-ylmethylamino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(NCc2ccc[nH]2)n[nH]c1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN6O/c16-9-3-1-4-10(7-9)20-15-12(13(17)23)14(21-22-15)19-8-11-5-2-6-18-11/h1-7,18H,8H2,(H2,17,23)(H3,19,20,21,22) |
| InChIKey | RSHFAOOQSVKACU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |