C17H13Cl2N5O2 — CID 136619558
5-(3-chloroanilino)-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 136619558) has the molecular formula C17H13Cl2N5O2 and a molecular weight of 390.23 g/mol. Its IUPAC name is 5-(3-chloroanilino)-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chloroanilino)-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136619558 |
| Molecular Formula | C17H13Cl2N5O2 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-(3-chloroanilino)-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(/N=C/c2cc(Cl)ccc2O)n[nH]c1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N5O2/c18-10-2-1-3-12(7-10)22-17-14(15(20)26)16(23-24-17)21-8-9-6-11(19)4-5-13(9)25/h1-8,25H,(H2,20,26)(H2,22,23,24)/b21-8+ |
| InChIKey | CSVPDJSXXZNZAA-ODCIPOBUSA-N |
| XLogP | 4.02 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|