C17H13ClN6O3 — CID 86701911
5-(3-chloroanilino)-3-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 86701911) has the molecular formula C17H13ClN6O3 and a molecular weight of 384.78 g/mol. Its IUPAC name is 5-(3-chloroanilino)-3-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chloroanilino)-3-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86701911 |
| Molecular Formula | C17H13ClN6O3 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 5-(3-chloroanilino)-3-[(4-nitrophenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(/N=C/c2ccc([N+](=O)[O-])cc2)n[nH]c1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13ClN6O3/c18-11-2-1-3-12(8-11)21-17-14(15(19)25)16(22-23-17)20-9-10-4-6-13(7-5-10)24(26)27/h1-9H,(H2,19,25)(H2,21,22,23)/b20-9+ |
| InChIKey | FLOWGKBNUXOFCS-AWQFTUOYSA-N |
| XLogP | 3.56 |
| TPSA | 139.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|