C15H13ClN6O — CID 136621793
5-(4-chloroanilino)-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carboxamide (PubChem CID 136621793) has the molecular formula C15H13ClN6O and a molecular weight of 328.76 g/mol. Its IUPAC name is 5-(4-chloroanilino)-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-chloroanilino)-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136621793 |
| Molecular Formula | C15H13ClN6O |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-(4-chloroanilino)-3-(1H-pyrrol-2-ylmethylideneamino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(/N=C/c2ccc[nH]2)n[nH]c1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN6O/c16-9-3-5-10(6-4-9)20-15-12(13(17)23)14(21-22-15)19-8-11-2-1-7-18-11/h1-8,18H,(H2,17,23)(H2,20,21,22)/b19-8+ |
| InChIKey | YXGFLDPXNGXOAS-UFWORHAWSA-N |
| XLogP | 2.98 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|