C18H13ClN4O2 — CID 157095862
5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile (PubChem CID 157095862) has the molecular formula C18H13ClN4O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 157095862 |
| Molecular Formula | C18H13ClN4O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(/N=C/c2cc(O)ccc2O)n[nH]c1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13ClN4O2/c19-13-3-1-2-11(6-13)7-16-15(9-20)18(23-22-16)21-10-12-8-14(24)4-5-17(12)25/h1-6,8,10,24-25H,7H2,(H,22,23)/b21-10+ |
| InChIKey | SCRRDZYPRJFSEH-UFFVCSGVSA-N |
| XLogP | 3.69 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|