C19H16IN5O — CID 136621783
3-[(2-hydroxy-4-methylphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carbonitrile (PubChem CID 136621783) has the molecular formula C19H16IN5O and a molecular weight of 457.28 g/mol. Its IUPAC name is 3-[(2-hydroxy-4-methylphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-[(2-hydroxy-4-methylphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 136621783 |
| Molecular Formula | C19H16IN5O |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 3-[(2-hydroxy-4-methylphenyl)methylideneamino]-5-[3-(iodomethyl)anilino]-1H-pyrazole-4-carbonitrile |
| SMILES | Cc1ccc(/C=N/c2n[nH]c(Nc3cccc(CI)c3)c2C#N)c(O)c1 |
| InChI | InChI=1S/C19H16IN5O/c1-12-5-6-14(17(26)7-12)11-22-18-16(10-21)19(25-24-18)23-15-4-2-3-13(8-15)9-20/h2-8,11,26H,9H2,1H3,(H2,23,24,25)/b22-11+ |
| InChIKey | SDDPGKDJRQOHBC-SSDVNMTOSA-N |
| XLogP | 4.72 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|