C19H15N5O2 — CID 158640788
5-benzyl-3-[(4-methyl-3-nitrophenyl)methylideneamino]-1H-pyrazole-4-carbonitrile (PubChem CID 158640788) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-benzyl-3-[(4-methyl-3-nitrophenyl)methylideneamino]-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-benzyl-3-[(4-methyl-3-nitrophenyl)methylideneamino]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 158640788 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 5-benzyl-3-[(4-methyl-3-nitrophenyl)methylideneamino]-1H-pyrazole-4-carbonitrile |
| SMILES | Cc1ccc(/C=N/c2n[nH]c(Cc3ccccc3)c2C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N5O2/c1-13-7-8-15(10-18(13)24(25)26)12-21-19-16(11-20)17(22-23-19)9-14-5-3-2-4-6-14/h2-8,10,12H,9H2,1H3,(H,22,23)/b21-12+ |
| InChIKey | LHNIZHDZQAFYQX-CIAFOILYSA-N |
| XLogP | 3.84 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|