C22H18N4O3S — CID 135670870
6-benzyl-2-[(4-hydroxy-3-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 135670870) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 6-benzyl-2-[(4-hydroxy-3-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 6-benzyl-2-[(4-hydroxy-3-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135670870 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 6-benzyl-2-[(4-hydroxy-3-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2ccc(O)c([N+](=O)[O-])c2)sc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C22H18N4O3S/c23-11-18-17-8-9-25(13-15-4-2-1-3-5-15)14-21(17)30-22(18)24-12-16-6-7-20(27)19(10-16)26(28)29/h1-7,10,12,27H,8-9,13-14H2 |
| InChIKey | PLAQLFXNOAVKNJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|