C24H22N4O4S — CID 23944761
6-benzyl-2-[(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 23944761) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is 6-benzyl-2-[(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 6-benzyl-2-[(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23944761 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 6-benzyl-2-[(4,5-dimethoxy-2-nitrophenyl)methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | COc1cc(C=Nc2sc3c(c2C#N)CCN(Cc2ccccc2)C3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H22N4O4S/c1-31-21-10-17(20(28(29)30)11-22(21)32-2)13-26-24-19(12-25)18-8-9-27(15-23(18)33-24)14-16-6-4-3-5-7-16/h3-7,10-11,13H,8-9,14-15H2,1-2H3 |
| InChIKey | ULXHZAVPZMILBE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 100.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|