C25H27N3O3 — CID 136625269
N-[3-benzyl-5-(3,4-dihydroxyphenyl)pyrazin-2-yl]-2-cyclohexylacetamide (PubChem CID 136625269) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[3-benzyl-5-(3,4-dihydroxyphenyl)pyrazin-2-yl]-2-cyclohexylacetamide.
| Compound Name | N-[3-benzyl-5-(3,4-dihydroxyphenyl)pyrazin-2-yl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 136625269 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[3-benzyl-5-(3,4-dihydroxyphenyl)pyrazin-2-yl]-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)Nc1ncc(-c2ccc(O)c(O)c2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C25H27N3O3/c29-22-12-11-19(15-23(22)30)21-16-26-25(20(27-21)13-17-7-3-1-4-8-17)28-24(31)14-18-9-5-2-6-10-18/h1,3-4,7-8,11-12,15-16,18,29-30H,2,5-6,9-10,13-14H2,(H,26,28,31) |
| InChIKey | PWBQBZPQWUSFLT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|