C6H9N5O2 — CID 136625743
6-(2-aminoethylimino)-5-imino-1,3-diazinane-2,4-dione (PubChem CID 136625743) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is 6-(2-aminoethylimino)-5-imino-1,3-diazinane-2,4-dione.
| Compound Name | 6-(2-aminoethylimino)-5-imino-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 136625743 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 6-(2-aminoethylimino)-5-imino-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\C(=O)NC(=O)N\C1=N/CCN |
| InChI | InChI=1S/C6H9N5O2/c7-1-2-9-4-3(8)5(12)11-6(13)10-4/h8H,1-2,7H2,(H2,9,10,11,12,13)/b8-3- |
| InChIKey | XRNRISLVZKGDRG-BAQGIRSFSA-N |
| XLogP | -1.80 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|