C28H36N6O — CID 136625866
5-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-2-(4-pentylcyclohexyl)-1H-pyrazol-3-one (PubChem CID 136625866) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is 5-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-2-(4-pentylcyclohexyl)-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-2-(4-pentylcyclohexyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 136625866 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 5-methyl-4-[[4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-2-(4-pentylcyclohexyl)-1H-pyrazol-3-one |
| SMILES | CCCCCC1CCC(n2[nH]c(C)c(/N=N/c3ccc(/N=N/c4ccc(C)cc4)cc3)c2=O)CC1 |
| InChI | InChI=1S/C28H36N6O/c1-4-5-6-7-22-10-18-26(19-11-22)34-28(35)27(21(3)33-34)32-31-25-16-14-24(15-17-25)30-29-23-12-8-20(2)9-13-23/h8-9,12-17,22,26,33H,4-7,10-11,18-19H2,1-3H3/b30-29+,32-31+ |
| InChIKey | RSGYHPNZBUCTEU-PNBBGTCESA-N |
| XLogP | 8.94 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|