C27H31F3N8O5S — CID 136629400
tert-butyl N-[3-[4-[2-[8-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-6-imino-7H-purin-3-yl]ethyl]piperidin-1-yl]-1,1,1-trifluoro-3-oxopropan-2-yl]carbamate (PubChem CID 136629400) has the molecular formula C27H31F3N8O5S and a molecular weight of 636.66 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[8-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-6-imino-7H-purin-3-yl]ethyl]piperidin-1-yl]-1,1,1-trifluoro-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[8-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-6-imino-7H-purin-3-yl]ethyl]piperidin-1-yl]-1,1,1-trifluoro-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 136629400 |
| Molecular Formula | C27H31F3N8O5S |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[8-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-6-imino-7H-purin-3-yl]ethyl]piperidin-1-yl]-1,1,1-trifluoro-3-oxopropan-2-yl]carbamate |
| SMILES | [H]/N=c1\ncn(CCC2CCN(C(=O)C(NC(=O)OC(C)(C)C)C(F)(F)F)CC2)c2nc(Sc3cc(O)c(O)cc3C#N)[nH]c12 |
| InChI | InChI=1S/C27H31F3N8O5S/c1-26(2,3)43-25(42)35-20(27(28,29)30)23(41)37-7-4-14(5-8-37)6-9-38-13-33-21(32)19-22(38)36-24(34-19)44-18-11-17(40)16(39)10-15(18)12-31/h10-11,13-14,20,32,39-40H,4-9H2,1-3H3,(H,34,36)(H,35,42)/b32-21- |
| InChIKey | VLEDQDZIVGPZLG-QXPFVDMISA-N |
| XLogP | 3.76 |
| TPSA | 193.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|