C24H31N7O4S — CID 136629396
2-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-5-(ethenylamino)-1-[2-[1-[(2R)-2-methoxypropanoyl]piperidin-4-yl]ethyl]imidazole-4-carboximidamide (PubChem CID 136629396) has the molecular formula C24H31N7O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is 2-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-5-(ethenylamino)-1-[2-[1-[(2R)-2-methoxypropanoyl]piperidin-4-yl]ethyl]imidazole-4-carboximidamide.
| Compound Name | 2-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-5-(ethenylamino)-1-[2-[1-[(2R)-2-methoxypropanoyl]piperidin-4-yl]ethyl]imidazole-4-carboximidamide |
|---|---|
| PubChem CID | 136629396 |
| Molecular Formula | C24H31N7O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 2-(2-cyano-4,5-dihydroxyphenyl)sulfanyl-5-(ethenylamino)-1-[2-[1-[(2R)-2-methoxypropanoyl]piperidin-4-yl]ethyl]imidazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(Sc2cc(O)c(O)cc2C#N)n(CCC2CCN(C(=O)[C@@H](C)OC)CC2)c1NC=C |
| InChI | InChI=1S/C24H31N7O4S/c1-4-28-22-20(21(26)27)29-24(36-19-12-18(33)17(32)11-16(19)13-25)31(22)10-7-15-5-8-30(9-6-15)23(34)14(2)35-3/h4,11-12,14-15,28,32-33H,1,5-10H2,2-3H3,(H3,26,27)/t14-/m1/s1 |
| InChIKey | ORSIPOSACCXLCZ-CQSZACIVSA-N |
| XLogP | 2.82 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|