C20H21N5O5S2 — CID 136637225
12-[2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl]sulfanyl-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one (PubChem CID 136637225) has the molecular formula C20H21N5O5S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 12-[2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl]sulfanyl-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one.
| Compound Name | 12-[2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl]sulfanyl-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one |
|---|---|
| PubChem CID | 136637225 |
| Molecular Formula | C20H21N5O5S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 12-[2-(3-morpholin-4-ylsulfonylphenyl)-2-oxoethyl]sulfanyl-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),9,11-trien-7-one |
| SMILES | O=C(CSc1nnc2[nH]c(=O)c3c(n12)CCC3)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H21N5O5S2/c26-17(13-3-1-4-14(11-13)32(28,29)24-7-9-30-10-8-24)12-31-20-23-22-19-21-18(27)15-5-2-6-16(15)25(19)20/h1,3-4,11H,2,5-10,12H2,(H,21,22,27) |
| InChIKey | CGIUHCLLPBEESU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |