C29H28Br3N7O4S2 — CID 136639904
2-[6-[(4-methylphenyl)sulfonylamino]-2,4-dihydro-1H-1,3,5-triazin-3-yl]acetic acid;5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)iminomethyl]-1H-pyrazole-3-thione (PubChem CID 136639904) has the molecular formula C29H28Br3N7O4S2 and a molecular weight of 842.43 g/mol. Its IUPAC name is 2-[6-[(4-methylphenyl)sulfonylamino]-2,4-dihydro-1H-1,3,5-triazin-3-yl]acetic acid;5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)iminomethyl]-1H-pyrazole-3-thione.
| Compound Name | 2-[6-[(4-methylphenyl)sulfonylamino]-2,4-dihydro-1H-1,3,5-triazin-3-yl]acetic acid;5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)iminomethyl]-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 136639904 |
| Molecular Formula | C29H28Br3N7O4S2 |
| Molecular Weight | 842.43 g/mol |
| Exact Mass | 838.92 |
| IUPAC Name | 2-[6-[(4-methylphenyl)sulfonylamino]-2,4-dihydro-1H-1,3,5-triazin-3-yl]acetic acid;5-methyl-2-phenyl-4-[(2,4,6-tribromophenyl)iminomethyl]-1H-pyrazole-3-thione |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=S)c1/C=N/c1c(Br)cc(Br)cc1Br.Cc1ccc(S(=O)(=O)NC2=NCN(CC(=O)O)CN2)cc1 |
| InChI | InChI=1S/C17H12Br3N3S.C12H16N4O4S/c1-10-13(9-21-16-14(19)7-11(18)8-15(16)20)17(24)23(22-10)12-5-3-2-4-6-12;1-9-2-4-10(5-3-9)21(19,20)15-12-13-7-16(8-14-12)6-11(17)18/h2-9,22H,1H3;2-5H,6-8H2,1H3,(H,17,18)(H2,13,14,15)/b21-9+; |
| InChIKey | RETJHQQLOIGGCD-CSFJJMQLSA-N |
| XLogP | 6.42 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|