C19H19N3S — CID 2863181
4-[(3,4-dimethylphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazole-3-thione (PubChem CID 2863181) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazole-3-thione.
| Compound Name | 4-[(3,4-dimethylphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 2863181 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazole-3-thione |
| SMILES | Cc1ccc(/N=C/c2c(C)[nH]n(-c3ccccc3)c2=S)cc1C |
| InChI | InChI=1S/C19H19N3S/c1-13-9-10-16(11-14(13)2)20-12-18-15(3)21-22(19(18)23)17-7-5-4-6-8-17/h4-12,21H,1-3H3/b20-12+ |
| InChIKey | NLJAIQVUYLVUDF-UDWIEESQSA-N |
| XLogP | 5.21 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|