C26H31N7O — CID 136641001
(Z)-3-ethenylimino-1-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]prop-1-en-1-amine (PubChem CID 136641001) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is (Z)-3-ethenylimino-1-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-ethenylimino-1-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 136641001 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (Z)-3-ethenylimino-1-[5-(1-methylcyclopropyl)oxy-1H-indazol-3-yl]-3-[4-(pyridin-4-ylmethyl)piperazin-1-yl]prop-1-en-1-amine |
| SMILES | C=C/N=C(/C=C(\N)c1n[nH]c2ccc(OC3(C)CC3)cc12)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C26H31N7O/c1-3-29-24(33-14-12-32(13-15-33)18-19-6-10-28-11-7-19)17-22(27)25-21-16-20(34-26(2)8-9-26)4-5-23(21)30-31-25/h3-7,10-11,16-17H,1,8-9,12-15,18,27H2,2H3,(H,30,31)/b22-17-,29-24- |
| InChIKey | VBOARRWFTNDIAG-CRIIPPORSA-N |
| XLogP | 3.55 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|