C18H25N5O2 — CID 142499118
3-(2,6-dimethylmorpholin-4-yl)-1-(5-methoxy-1H-indazol-3-yl)-3-methyliminoprop-1-en-1-amine (PubChem CID 142499118) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-1-(5-methoxy-1H-indazol-3-yl)-3-methyliminoprop-1-en-1-amine.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-1-(5-methoxy-1H-indazol-3-yl)-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 142499118 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-1-(5-methoxy-1H-indazol-3-yl)-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C(/C=C(N)c1n[nH]c2ccc(OC)cc12)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H25N5O2/c1-11-9-23(10-12(2)25-11)17(20-3)8-15(19)18-14-7-13(24-4)5-6-16(14)21-22-18/h5-8,11-12H,9-10,19H2,1-4H3,(H,21,22)/b15-8?,20-17- |
| InChIKey | TZVHRTNWTQAKHU-PJZGTPCQSA-N |
| XLogP | 2.01 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|