C20H29N7O2 — CID 136643698
[(1S,3R,4S)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl] N-[3-(dimethylamino)propyl]carbamate (PubChem CID 136643698) has the molecular formula C20H29N7O2 and a molecular weight of 399.50 g/mol. Its IUPAC name is [(1S,3R,4S)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl] N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | [(1S,3R,4S)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl] N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 136643698 |
| Molecular Formula | C20H29N7O2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [(1S,3R,4S)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl] N-[3-(dimethylamino)propyl]carbamate |
| SMILES | CC[C@@H]1C[C@H](OC(=O)NCCCN(C)C)C[C@@H]1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C20H29N7O2/c1-4-13-10-14(29-20(28)22-7-5-9-26(2)3)11-15(13)19-25-24-17-12-23-18-16(27(17)19)6-8-21-18/h6,8,12-15,21H,4-5,7,9-11H2,1-3H3,(H,22,28)/t13-,14+,15+/m1/s1 |
| InChIKey | NZCKPYXNFBSTOF-ILXRZTDVSA-N |
| XLogP | 2.56 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|