C19H25N5O3S — CID 137131608
4-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxythiane 1,1-dioxide (PubChem CID 137131608) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxythiane 1,1-dioxide.
| Compound Name | 4-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxythiane 1,1-dioxide |
|---|---|
| PubChem CID | 137131608 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]oxythiane 1,1-dioxide |
| SMILES | CCC1CC(OC2CCS(=O)(=O)CC2)CC1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C19H25N5O3S/c1-2-12-9-14(27-13-4-7-28(25,26)8-5-13)10-15(12)19-23-22-17-11-21-18-16(24(17)19)3-6-20-18/h3,6,11-15,20H,2,4-5,7-10H2,1H3 |
| InChIKey | UAJOCMCMEOJPGZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |