C18H24BN9O9P+ — CID 136645483
CID 136645483 (PubChem CID 136645483) has the molecular formula C18H24BN9O9P+ and a molecular weight of 552.23 g/mol.
| Compound Name | CID 136645483 |
|---|---|
| PubChem CID | 136645483 |
| Molecular Formula | C18H24BN9O9P+ |
| Molecular Weight | 552.23 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | — |
| SMILES | [B][P+](O)(OC[C@H]1O[C@@H](n2cnc(N)nc2=O)C[C@H]1O)O[C@@H]1C[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C18H24BN9O9P/c19-38(33,34-4-10-7(30)1-11(36-10)28-6-23-16(20)26-18(28)32)37-8-2-12(35-9(8)3-29)27-5-22-13-14(27)24-17(21)25-15(13)31/h5-12,29-30,33H,1-4H2,(H2,20,26,32)(H3,21,24,25,31)/q+1/t7-,8-,9-,10-,11-,12-,38?/m1/s1 |
| InChIKey | QDJSNANXDADUTH-YRHAPDLKSA-N |
| XLogP | -2.90 |
| TPSA | 261.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.23 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|