C42H50N4O2 — CID 136648548
2,4-ditert-butyl-6-[[6-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol (PubChem CID 136648548) has the molecular formula C42H50N4O2 and a molecular weight of 642.89 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[6-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[6-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136648548 |
| Molecular Formula | C42H50N4O2 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 2,4-ditert-butyl-6-[[6-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/c2c(/N=C/c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)c3cccnc3c3ncccc23)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H50N4O2/c1-39(2,3)27-19-25(37(47)31(21-27)41(7,8)9)23-45-35-29-15-13-17-43-33(29)34-30(16-14-18-44-34)36(35)46-24-26-20-28(40(4,5)6)22-32(38(26)48)42(10,11)12/h13-24,47-48H,1-12H3/b45-23+,46-24+ |
| InChIKey | FYFKKEQHYFWGKE-ZXHWGKOWSA-N |
| XLogP | 10.89 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|