C28H20N2O4 — CID 136653630
ethane;2-[2-(1-hydroxy-3-oxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione (PubChem CID 136653630) has the molecular formula C28H20N2O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is ethane;2-[2-(1-hydroxy-3-oxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione.
| Compound Name | ethane;2-[2-(1-hydroxy-3-oxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 136653630 |
| Molecular Formula | C28H20N2O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | ethane;2-[2-(1-hydroxy-3-oxoinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
| SMILES | CC.O=C1C(c2ccc3cccc(N4C(=O)c5ccccc5C4=O)c3n2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C26H14N2O4.C2H6/c29-23-15-7-1-2-8-16(15)24(30)21(23)19-13-12-14-6-5-11-20(22(14)27-19)28-25(31)17-9-3-4-10-18(17)26(28)32;1-2/h1-13,29H;1-2H3 |
| InChIKey | FVASZCGWXGFWLD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|