C15H10N4O2 — CID 168516586
2-(2-methylbenzotriazol-4-yl)isoindole-1,3-dione (PubChem CID 168516586) has the molecular formula C15H10N4O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(2-methylbenzotriazol-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-methylbenzotriazol-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516586 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-(2-methylbenzotriazol-4-yl)isoindole-1,3-dione |
| SMILES | Cn1nc2cccc(N3C(=O)c4ccccc4C3=O)c2n1 |
| InChI | InChI=1S/C15H10N4O2/c1-18-16-11-7-4-8-12(13(11)17-18)19-14(20)9-5-2-3-6-10(9)15(19)21/h2-8H,1H3 |
| InChIKey | URFKMQNYSFLZAR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|