C26H31F2N3O2S — CID 136656028
N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2,6-difluorobenzenesulfonamide (PubChem CID 136656028) has the molecular formula C26H31F2N3O2S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 136656028 |
| Molecular Formula | C26H31F2N3O2S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]-2,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\C[C@H]3c4ccccc4CC[C@H]3N2)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C26H31F2N3O2S/c27-22-6-3-7-23(28)26(22)34(32,33)30-16-18-10-8-17(9-11-18)15-29-25-14-21-20-5-2-1-4-19(20)12-13-24(21)31-25/h1-7,17-18,21,24,30H,8-16H2,(H,29,31)/t17?,18?,21-,24+/m0/s1 |
| InChIKey | JJQLPVWGTKKDRP-QBEJEKAMSA-N |
| XLogP | 4.54 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|