C27H34FN3O3S — CID 59978945
N-[[4-[[[(3aR,9bS)-7-methoxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide (PubChem CID 59978945) has the molecular formula C27H34FN3O3S and a molecular weight of 499.65 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-7-methoxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-7-methoxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59978945 |
| Molecular Formula | C27H34FN3O3S |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-7-methoxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
| SMILES | COc1ccc2c(c1)CC[C@H]1N=C(NCC3CCC(CNS(=O)(=O)c4ccccc4F)CC3)C[C@@H]21 |
| InChI | InChI=1S/C27H34FN3O3S/c1-34-21-11-12-22-20(14-21)10-13-25-23(22)15-27(31-25)29-16-18-6-8-19(9-7-18)17-30-35(32,33)26-5-3-2-4-24(26)28/h2-5,11-12,14,18-19,23,25,30H,6-10,13,15-17H2,1H3,(H,29,31)/t18?,19?,23-,25+/m0/s1 |
| InChIKey | UTIVRFVHAVYEJU-MBRKVCQLSA-N |
| XLogP | 4.41 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |