C8H10N2O3 — CID 136661640
5-[(E)-(methylhydrazinylidene)methyl]benzene-1,2,4-triol (PubChem CID 136661640) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 5-[(E)-(methylhydrazinylidene)methyl]benzene-1,2,4-triol.
| Compound Name | 5-[(E)-(methylhydrazinylidene)methyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 136661640 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 5-[(E)-(methylhydrazinylidene)methyl]benzene-1,2,4-triol |
| SMILES | CN/N=C/c1cc(O)c(O)cc1O |
| InChI | InChI=1S/C8H10N2O3/c1-9-10-4-5-2-7(12)8(13)3-6(5)11/h2-4,9,11-13H,1H3/b10-4+ |
| InChIKey | YICYLDQZWYSANX-ONNFQVAWSA-N |
| XLogP | 0.36 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|