C18H13ClN2O — CID 136665622
2-(4-chlorophenyl)-4-cinnamylidene-1H-imidazol-5-one (PubChem CID 136665622) has the molecular formula C18H13ClN2O and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-cinnamylidene-1H-imidazol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-cinnamylidene-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136665622 |
| Molecular Formula | C18H13ClN2O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(4-chlorophenyl)-4-cinnamylidene-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(Cl)cc2)=NC1=CC=Cc1ccccc1 |
| InChI | InChI=1S/C18H13ClN2O/c19-15-11-9-14(10-12-15)17-20-16(18(22)21-17)8-4-7-13-5-2-1-3-6-13/h1-12H,(H,20,21,22) |
| InChIKey | CACUWAUJSCAFEO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|