C28H40N6O2 — CID 136671865
4,15-dimethyl-1,8,11,18,21,27-hexazatetracyclo[16.6.6.12,6.113,17]dotriaconta-2,4,6(32),7,11,13(31),14,16-octaene-31,32-diol (PubChem CID 136671865) has the molecular formula C28H40N6O2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 4,15-dimethyl-1,8,11,18,21,27-hexazatetracyclo[16.6.6.12,6.113,17]dotriaconta-2,4,6(32),7,11,13(31),14,16-octaene-31,32-diol.
| Compound Name | 4,15-dimethyl-1,8,11,18,21,27-hexazatetracyclo[16.6.6.12,6.113,17]dotriaconta-2,4,6(32),7,11,13(31),14,16-octaene-31,32-diol |
|---|---|
| PubChem CID | 136671865 |
| Molecular Formula | C28H40N6O2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | 4,15-dimethyl-1,8,11,18,21,27-hexazatetracyclo[16.6.6.12,6.113,17]dotriaconta-2,4,6(32),7,11,13(31),14,16-octaene-31,32-diol |
| SMILES | Cc1cc2c(O)c(c1)N1CCCNCCN(CCCNCC1)c1cc(C)cc(c1O)/C=N\CC/N=C\2 |
| InChI | InChI=1S/C28H40N6O2/c1-21-15-23-19-31-7-8-32-20-24-16-22(2)18-26(28(24)36)34-12-4-6-29-9-13-33(25(17-21)27(23)35)11-3-5-30-10-14-34/h15-20,29-30,35-36H,3-14H2,1-2H3/b31-19-,32-20- |
| InChIKey | SDNJSFLGCHWFEL-CDSIFPFTSA-N |
| XLogP | 2.85 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |