C32H40N6O2 — CID 136671868
4,19-dimethyl-1,8,15,22,25,31-hexazapentacyclo[20.6.6.12,6.117,21.09,14]hexatriaconta-2,4,6(36),7,9,11,13,15,17(35),18,20-undecaene-35,36-diol (PubChem CID 136671868) has the molecular formula C32H40N6O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 4,19-dimethyl-1,8,15,22,25,31-hexazapentacyclo[20.6.6.12,6.117,21.09,14]hexatriaconta-2,4,6(36),7,9,11,13,15,17(35),18,20-undecaene-35,36-diol.
| Compound Name | 4,19-dimethyl-1,8,15,22,25,31-hexazapentacyclo[20.6.6.12,6.117,21.09,14]hexatriaconta-2,4,6(36),7,9,11,13,15,17(35),18,20-undecaene-35,36-diol |
|---|---|
| PubChem CID | 136671868 |
| Molecular Formula | C32H40N6O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 4,19-dimethyl-1,8,15,22,25,31-hexazapentacyclo[20.6.6.12,6.117,21.09,14]hexatriaconta-2,4,6(36),7,9,11,13,15,17(35),18,20-undecaene-35,36-diol |
| SMILES | Cc1cc2c(O)c(c1)N1CCCNCCN(CCCNCC1)c1cc(C)cc(c1O)/C=N\c1ccccc1/N=C\2 |
| InChI | InChI=1S/C32H40N6O2/c1-23-17-25-21-35-27-7-3-4-8-28(27)36-22-26-18-24(2)20-30(32(26)40)38-14-6-10-33-11-15-37(29(19-23)31(25)39)13-5-9-34-12-16-38/h3-4,7-8,17-22,33-34,39-40H,5-6,9-16H2,1-2H3/b35-21-,36-22- |
| InChIKey | ZZWJJYRXPNONFB-XEMPJQOTSA-N |
| XLogP | 4.82 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |