C19H34N6O — CID 102312654
4-methyl-2,6-bis(1,4,7-triazonan-1-yl)phenol (PubChem CID 102312654) has the molecular formula C19H34N6O and a molecular weight of 362.52 g/mol. Its IUPAC name is 4-methyl-2,6-bis(1,4,7-triazonan-1-yl)phenol.
| Compound Name | 4-methyl-2,6-bis(1,4,7-triazonan-1-yl)phenol |
|---|---|
| PubChem CID | 102312654 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 4-methyl-2,6-bis(1,4,7-triazonan-1-yl)phenol |
| SMILES | Cc1cc(N2CCNCCNCC2)c(O)c(N2CCNCCNCC2)c1 |
| InChI | InChI=1S/C19H34N6O/c1-16-14-17(24-10-6-20-2-3-21-7-11-24)19(26)18(15-16)25-12-8-22-4-5-23-9-13-25/h14-15,20-23,26H,2-13H2,1H3 |
| InChIKey | KIZCRBNGKGUQBS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |