C38H66N10O2Zn2+4 — CID 6395176
dizinc;8,28-dimethyl-1,4,12,15,18,21,24,32,35,38-decazapentacyclo[33.5.2.215,21.16,10.126,30]hexatetraconta-6,8,10(46),26(43),27,29-hexaene-43,46-diol (PubChem CID 6395176) has the molecular formula C38H66N10O2Zn2+4 and a molecular weight of 825.79 g/mol. Its IUPAC name is dizinc;8,28-dimethyl-1,4,12,15,18,21,24,32,35,38-decazapentacyclo[33.5.2.215,21.16,10.126,30]hexatetraconta-6,8,10(46),26(43),27,29-hexaene-43,46-diol.
| Compound Name | dizinc;8,28-dimethyl-1,4,12,15,18,21,24,32,35,38-decazapentacyclo[33.5.2.215,21.16,10.126,30]hexatetraconta-6,8,10(46),26(43),27,29-hexaene-43,46-diol |
|---|---|
| PubChem CID | 6395176 |
| Molecular Formula | C38H66N10O2Zn2+4 |
| Molecular Weight | 825.79 g/mol |
| Exact Mass | 822.39 |
| IUPAC Name | dizinc;8,28-dimethyl-1,4,12,15,18,21,24,32,35,38-decazapentacyclo[33.5.2.215,21.16,10.126,30]hexatetraconta-6,8,10(46),26(43),27,29-hexaene-43,46-diol |
| SMILES | Cc1cc2c(O)c(c1)CNCCN1CCNCCN(CCNCc3cc(C)cc(c3O)CNCCN3CCNCCN(CCNC2)CC3)CC1.[Zn+2].[Zn+2] |
| InChI | InChI=1S/C38H66N10O2.2Zn/c1-31-23-33-27-41-7-15-45-11-3-39-5-13-47(21-19-45)17-9-43-29-35-25-32(2)26-36(38(35)50)30-44-10-18-48-14-6-40-4-12-46(20-22-48)16-8-42-28-34(24-31)37(33)49;;/h23-26,39-44,49-50H,3-22,27-30H2,1-2H3;;/q;2*+2 |
| InChIKey | WHOSAPKKOBSAMX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 125.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.79 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|