C34H58N6O2 — CID 157161281
13,27-ditert-butyl-6,20-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-29,30-diol (PubChem CID 157161281) has the molecular formula C34H58N6O2 and a molecular weight of 582.88 g/mol. Its IUPAC name is 13,27-ditert-butyl-6,20-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-29,30-diol.
| Compound Name | 13,27-ditert-butyl-6,20-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-29,30-diol |
|---|---|
| PubChem CID | 157161281 |
| Molecular Formula | C34H58N6O2 |
| Molecular Weight | 582.88 g/mol |
| Exact Mass | 582.46 |
| IUPAC Name | 13,27-ditert-butyl-6,20-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-29,30-diol |
| SMILES | CN1CCNCc2cc(C(C)(C)C)cc(c2O)CNCCN(C)CCNCc2cc(C(C)(C)C)cc(c2O)CNCC1 |
| InChI | InChI=1S/C34H58N6O2/c1-33(2,3)29-17-25-21-35-9-13-39(7)15-11-37-23-27-19-30(34(4,5)6)20-28(32(27)42)24-38-12-16-40(8)14-10-36-22-26(18-29)31(25)41/h17-20,35-38,41-42H,9-16,21-24H2,1-8H3 |
| InChIKey | GYIOVWIJXQLCGU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|