C36H56N4O2 — CID 118303430
14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),12,14,16(32),27(31),28-hexaene-31,32-diol (PubChem CID 118303430) has the molecular formula C36H56N4O2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),12,14,16(32),27(31),28-hexaene-31,32-diol.
| Compound Name | 14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),12,14,16(32),27(31),28-hexaene-31,32-diol |
|---|---|
| PubChem CID | 118303430 |
| Molecular Formula | C36H56N4O2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | 14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),12,14,16(32),27(31),28-hexaene-31,32-diol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)CNC1CCCCC1NCc1cc(C(C)(C)C)cc(c1O)CNC1CCCCC1NC2 |
| InChI | InChI=1S/C36H56N4O2/c1-35(2,3)27-15-23-19-37-29-11-7-9-13-31(29)39-21-25-17-28(36(4,5)6)18-26(34(25)42)22-40-32-14-10-8-12-30(32)38-20-24(16-27)33(23)41/h15-18,29-32,37-42H,7-14,19-22H2,1-6H3 |
| InChIKey | YGRPSWPKOYDFME-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|